* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-ETHYL-1,2,4-OXADIAZOL-5-YL)-2-PHENYLETHAN-1-AMINE |
English Synonyms: | 1-(3-ETHYL-1,2,4-OXADIAZOL-5-YL)-2-PHENYLETHAN-1-AMINE ; 1-(3-ETHYL-[1,2,4]OXADIAZOL-5-YL)-2-PHENYL-ETHYLAMINE |
MDL Number.: | MFCD11123258 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nc(on1)C(Cc2ccccc2)N |
InChi: | InChI=1S/C12H15N3O/c1-2-11-14-12(16-15-11)10(13)8-9-6-4-3-5-7-9/h3-7,10H,2,8,13H2,1H3 |
InChiKey: | InChIKey=HJBOZCHDFDWELV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.