* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[4-(2,2,2-TRIFLUOROETHOXY)PHENYL]PROPAN-1-ONE |
English Synonyms: | 1-[4-(2,2,2-TRIFLUOROETHOXY)PHENYL]PROPAN-1-ONE |
MDL Number.: | MFCD11127574 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(=O)c1ccc(cc1)OCC(F)(F)F |
InChi: | InChI=1S/C11H11F3O2/c1-2-10(15)8-3-5-9(6-4-8)16-7-11(12,13)14/h3-6H,2,7H2,1H3 |
InChiKey: | InChIKey=QSBAFYXUIVJTKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.