* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-1-(5-CHLORO-1,3-BENZOTHIAZOL-2-YL)PROPAN-2-OL |
English Synonyms: | 1-AMINO-1-(5-CHLORO-1,3-BENZOTHIAZOL-2-YL)PROPAN-2-OL |
MDL Number.: | MFCD11128793 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C(c1nc2cc(ccc2s1)Cl)N)O |
InChi: | InChI=1S/C10H11ClN2OS/c1-5(14)9(12)10-13-7-4-6(11)2-3-8(7)15-10/h2-5,9,14H,12H2,1H3 |
InChiKey: | InChIKey=HAGHXXUDOQFADS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.