* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(3-BROMOPROPYL)-9H-CARBAZOLE |
CAS: | 84359-61-5 |
English Synonyms: | 9-(3-BROMOPROPYL)-9H-CARBAZOLE |
MDL Number.: | MFCD11164489 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c3ccccc3n2CCCBr |
InChi: | InChI=1S/C15H14BrN/c16-10-5-11-17-14-8-3-1-6-12(14)13-7-2-4-9-15(13)17/h1-4,6-9H,5,10-11H2 |
InChiKey: | InChIKey=KJSZNBRGRCCYHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.