* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHOXY-1H,2H,3H,4H,5H,10H-AZEPINO[3,4-B]INDOLE |
English Synonyms: | 9-METHOXY-1H,2H,3H,4H,5H,10H-AZEPINO[3,4-B]INDOLE |
MDL Number.: | MFCD11168330 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | COC=1C=CC=C2C3=C(NC12)CNCCC3 |
InChi: | InChI=1S/C13H16N2O/c1-16-12-6-2-4-10-9-5-3-7-14-8-11(9)15-13(10)12/h2,4,6,14-15H,3,5,7-8H2,1H3 |
InChiKey: | InChIKey=VJVJQNNSELPHIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.