* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-1H,2H,3H,4H,5H,6H-AZEPINO[4,3-B]INDOL-1-ONE |
English Synonyms: | 9-METHYL-1H,2H,3H,4H,5H,6H-AZEPINO[4,3-B]INDOL-1-ONE |
MDL Number.: | MFCD11168372 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc2c(c1)c3c([nH]2)CCCNC3=O |
InChi: | InChI=1S/C13H14N2O/c1-8-4-5-10-9(7-8)12-11(15-10)3-2-6-14-13(12)16/h4-5,7,15H,2-3,6H2,1H3,(H,14,16) |
InChiKey: | InChIKey=OEAXAGUSEQQNHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.