* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-1,2,3,4,5,6-HEXAHYDROAZEPINO[4,3-B]INDOLE |
CAS: | 1038264-37-7 |
English Synonyms: | 9-CHLORO-1,2,3,4,5,6-HEXAHYDROAZEPINO[4,3-B]INDOLE ; 9-CHLORO-1H,2H,3H,4H,5H,6H-AZEPINO[4,3-B]INDOLE |
MDL Number.: | MFCD11168373 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1Cl)c3c([nH]2)CCCNC3 |
InChi: | InChI=1S/C12H13ClN2/c13-8-3-4-12-9(6-8)10-7-14-5-1-2-11(10)15-12/h3-4,6,14-15H,1-2,5,7H2 |
InChiKey: | InChIKey=UBLNKVCLNUQTJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.