* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(1,2-OXAZOL-5-YLMETHYL)-1,4-DIAZEPANE |
| English Synonyms: | 1-(1,2-OXAZOL-5-YLMETHYL)-1,4-DIAZEPANE |
| MDL Number.: | MFCD11170986 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cnoc1CN2CCCNCC2 |
| InChi: | InChI=1S/C9H15N3O/c1-3-10-5-7-12(6-1)8-9-2-4-11-13-9/h2,4,10H,1,3,5-8H2 |
| InChiKey: | InChIKey=ANFJBGQXZNQFCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.