* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)METHYL]-1,4-DIAZEPANE |
English Synonyms: | 1-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)METHYL]-1,4-DIAZEPANE |
MDL Number.: | MFCD11170992 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1nnc(o1)CN2CCCNCC2 |
InChi: | InChI=1S/C9H16N4O/c1-8-11-12-9(14-8)7-13-5-2-3-10-4-6-13/h10H,2-7H2,1H3 |
InChiKey: | InChIKey=GXPVPFHFUUQNRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.