* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-[(3-METHYL-1,2-OXAZOL-5-YL)METHYL]-1,4-DIAZEPANE |
| English Synonyms: | 1-[(3-METHYL-1,2-OXAZOL-5-YL)METHYL]-1,4-DIAZEPANE |
| MDL Number.: | MFCD11170994 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1cc(on1)CN2CCCNCC2 |
| InChi: | InChI=1S/C10H17N3O/c1-9-7-10(14-12-9)8-13-5-2-3-11-4-6-13/h7,11H,2-6,8H2,1H3 |
| InChiKey: | InChIKey=YGYVWOBXCFICNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.