* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(3-ETHYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-[1,4]DIAZEPANE |
| English Synonyms: | 1-(3-ETHYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-[1,4]DIAZEPANE |
| MDL Number.: | MFCD11170996 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCc1nc(on1)CN2CCCNCC2 |
| InChi: | InChI=1S/C10H18N4O/c1-2-9-12-10(15-13-9)8-14-6-3-4-11-5-7-14/h11H,2-8H2,1H3 |
| InChiKey: | InChIKey=RIIJVVPUWPLDLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.