* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-[(5-METHYL-1,2-OXAZOL-3-YL)METHYL]PIPERIDIN-4-ONE |
| English Synonyms: | 1-[(5-METHYL-1,2-OXAZOL-3-YL)METHYL]PIPERIDIN-4-ONE |
| MDL Number.: | MFCD11171153 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1cc(no1)CN2CCC(=O)CC2 |
| InChi: | InChI=1S/C10H14N2O2/c1-8-6-9(11-14-8)7-12-4-2-10(13)3-5-12/h6H,2-5,7H2,1H3 |
| InChiKey: | InChIKey=IQUBPITUUMENGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.