* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(1,2,4-OXADIAZOL-3-YLMETHYL)PIPERIDIN-4-ONE |
| English Synonyms: | 1-(1,2,4-OXADIAZOL-3-YLMETHYL)PIPERIDIN-4-ONE |
| MDL Number.: | MFCD11171160 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1nc(no1)CN2CCC(=O)CC2 |
| InChi: | InChI=1S/C8H11N3O2/c12-7-1-3-11(4-2-7)5-8-9-6-13-10-8/h6H,1-5H2 |
| InChiKey: | InChIKey=ZFDNMNKXYLCBKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.