* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[(3-ETHYL-1,2,4-OXADIAZOL-5-YL)METHYL]PIPERIDIN-4-ONE |
English Synonyms: | 1-[(3-ETHYL-1,2,4-OXADIAZOL-5-YL)METHYL]PIPERIDIN-4-ONE |
MDL Number.: | MFCD11171167 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCc1nc(on1)CN2CCC(=O)CC2 |
InChi: | InChI=1S/C10H15N3O2/c1-2-9-11-10(15-12-9)7-13-5-3-8(14)4-6-13/h2-7H2,1H3 |
InChiKey: | InChIKey=RSAUMRMFUPEMJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.