* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(4-AMINO-2-METHYLPHENYL)-3-BUTYLUREA |
| English Synonyms: | 1-(4-AMINO-2-METHYLPHENYL)-3-BUTYLUREA |
| MDL Number.: | MFCD11171873 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | CCCCNC(=O)Nc1ccc(cc1C)N |
| InChi: | InChI=1S/C12H19N3O/c1-3-4-7-14-12(16)15-11-6-5-10(13)8-9(11)2/h5-6,8H,3-4,7,13H2,1-2H3,(H2,14,15,16) |
| InChiKey: | InChIKey=DVIXHAKCOFRQLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.