* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[2-(2,3-DIHYDRO-1H-INDOL-3-YL)ETHYL]-3-PROPYLUREA |
English Synonyms: | 1-[2-(2,3-DIHYDRO-1H-INDOL-3-YL)ETHYL]-3-PROPYLUREA |
MDL Number.: | MFCD11172102 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CCCNC(=O)NCCC1CNc2c1cccc2 |
InChi: | InChI=1S/C14H21N3O/c1-2-8-15-14(18)16-9-7-11-10-17-13-6-4-3-5-12(11)13/h3-6,11,17H,2,7-10H2,1H3,(H2,15,16,18) |
InChiKey: | InChIKey=OGWMZTFYKJERSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.