* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-BUTYL-3-(2-CYANOETHYL)-3-METHYLUREA |
| English Synonyms: | 1-BUTYL-3-(2-CYANOETHYL)-3-METHYLUREA |
| MDL Number.: | MFCD11172198 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCNC(=O)N(C)CCC#N |
| InChi: | InChI=1S/C9H17N3O/c1-3-4-7-11-9(13)12(2)8-5-6-10/h3-5,7-8H2,1-2H3,(H,11,13) |
| InChiKey: | InChIKey=INPAZPOPLNLKFB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.