* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-PHENYL-2-(1H-1,2,4-TRIAZOL-1-YL)BUTAN-1-AMINE |
| English Synonyms: | 1-PHENYL-2-(1H-1,2,4-TRIAZOL-1-YL)BUTAN-1-AMINE |
| MDL Number.: | MFCD11172979 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCC(C(c1ccccc1)N)n2cncn2 |
| InChi: | InChI=1S/C12H16N4/c1-2-11(16-9-14-8-15-16)12(13)10-6-4-3-5-7-10/h3-9,11-12H,2,13H2,1H3 |
| InChiKey: | InChIKey=FDVSEXLEHJJCIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.