* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-3-(AZOCAN-1-YL)PROPAN-2-OL |
English Synonyms: | 1-AMINO-3-(AZOCAN-1-YL)PROPAN-2-OL |
MDL Number.: | MFCD11173331 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1CCCN(CCC1)CC(CN)O |
InChi: | InChI=1S/C10H22N2O/c11-8-10(13)9-12-6-4-2-1-3-5-7-12/h10,13H,1-9,11H2 |
InChiKey: | InChIKey=FZCNEZMSUCRHCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.