* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(AZOCAN-1-YL)BUTANE-1,3-DIONE |
English Synonyms: | 1-(AZOCAN-1-YL)BUTANE-1,3-DIONE |
MDL Number.: | MFCD11173370 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(=O)CC(=O)N1CCCCCCC1 |
InChi: | InChI=1S/C11H19NO2/c1-10(13)9-11(14)12-7-5-3-2-4-6-8-12/h2-9H2,1H3 |
InChiKey: | InChIKey=NSSJMAZYGPLSLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.