* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(PYRIDIN-3-YL)OCTANE-1,3-DIONE |
English Synonyms: | 1-(PYRIDIN-3-YL)OCTANE-1,3-DIONE |
MDL Number.: | MFCD11178605 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCCCC(=O)CC(=O)c1cccnc1 |
InChi: | InChI=1S/C13H17NO2/c1-2-3-4-7-12(15)9-13(16)11-6-5-8-14-10-11/h5-6,8,10H,2-4,7,9H2,1H3 |
InChiKey: | InChIKey=YOPVLTHXDNGVHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.