* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1,3-BENZOXAZOL-2-YL)-4-METHOXYBUTAN-2-AMINE |
English Synonyms: | 1-(1,3-BENZOXAZOL-2-YL)-4-METHOXYBUTAN-2-AMINE |
MDL Number.: | MFCD11178755 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COCCC(Cc1nc2ccccc2o1)N |
InChi: | InChI=1S/C12H16N2O2/c1-15-7-6-9(13)8-12-14-10-4-2-3-5-11(10)16-12/h2-5,9H,6-8,13H2,1H3 |
InChiKey: | InChIKey=QRYWAXKSMMWMTL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.