* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1-METHYL-1H-INDOL-3-YL)PROPAN-1-ONE |
English Synonyms: | 1-(1-METHYL-1H-INDOL-3-YL)PROPAN-1-ONE |
MDL Number.: | MFCD11179428 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(=O)c1cn(c2c1cccc2)C |
InChi: | InChI=1S/C12H13NO/c1-3-12(14)10-8-13(2)11-7-5-4-6-9(10)11/h4-8H,3H2,1-2H3 |
InChiKey: | InChIKey=CJHZZTMCVWQEBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.