* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[(5-NITROFURAN-2-YL)METHYL]-1,4-DIAZEPANE |
English Synonyms: | 1-[(5-NITROFURAN-2-YL)METHYL]-1,4-DIAZEPANE |
MDL Number.: | MFCD11181541 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(oc1CN2CCCNCC2)[N+](=O)[O-] |
InChi: | InChI=1S/C10H15N3O3/c14-13(15)10-3-2-9(16-10)8-12-6-1-4-11-5-7-12/h2-3,11H,1,4-8H2 |
InChiKey: | InChIKey=ATQULFYEUNQSHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.