* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-BROMOPROPOXY)-3-IODOBENZENE |
CAS: | 908576-63-6 |
English Synonyms: | 1-(3-BROMOPROPOXY)-3-IODOBENZENE |
MDL Number.: | MFCD11182883 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)I)OCCCBr |
InChi: | InChI=1S/C9H10BrIO/c10-5-2-6-12-9-4-1-3-8(11)7-9/h1,3-4,7H,2,5-6H2 |
InChiKey: | InChIKey=LZYAADAPQLXKRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.