* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BENZYL-1-ETHYLUREA |
English Synonyms: | 1-BENZYL-1-ETHYLUREA |
MDL Number.: | MFCD11183380 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCN(Cc1ccccc1)C(=O)N |
InChi: | InChI=1S/C10H14N2O/c1-2-12(10(11)13)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,11,13) |
InChiKey: | InChIKey=JVXFKBQMKVNTJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.