* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(4-ETHYLPHENYL)-4,4-DIMETHYLPENTANE-1,3-DIONE |
| English Synonyms: | 1-(4-ETHYLPHENYL)-4,4-DIMETHYLPENTANE-1,3-DIONE |
| MDL Number.: | MFCD11185154 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCc1ccc(cc1)C(=O)CC(=O)C(C)(C)C |
| InChi: | InChI=1S/C15H20O2/c1-5-11-6-8-12(9-7-11)13(16)10-14(17)15(2,3)4/h6-9H,5,10H2,1-4H3 |
| InChiKey: | InChIKey=FWCJQLYQNFNERN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.