* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(BUTAN-2-YL)-3-(3-CHLOROPROPANOYL)UREA |
| English Synonyms: | 1-(BUTAN-2-YL)-3-(3-CHLOROPROPANOYL)UREA |
| MDL Number.: | MFCD11185218 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCC(C)NC(=O)NC(=O)CCCl |
| InChi: | InChI=1S/C8H15ClN2O2/c1-3-6(2)10-8(13)11-7(12)4-5-9/h6H,3-5H2,1-2H3,(H2,10,11,12,13) |
| InChiKey: | InChIKey=VDAZGQPDKBBBAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.