* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2-DICHLORO-4-(1-CHLOROETHYL)BENZENE |
| CAS: | 54965-01-4 |
| English Synonyms: | 1,2-DICHLORO-4-(1-CHLOROETHYL)BENZENE |
| MDL Number.: | MFCD11186440 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC(c1ccc(c(c1)Cl)Cl)Cl |
| InChi: | InChI=1S/C8H7Cl3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-5H,1H3 |
| InChiKey: | InChIKey=RFVRMZZXXWUCEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.