* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(1-CHLOROETHYL)-4-PROPOXYBENZENE |
| English Synonyms: | 1-(1-CHLOROETHYL)-4-PROPOXYBENZENE |
| MDL Number.: | MFCD11186444 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCCOc1ccc(cc1)C(C)Cl |
| InChi: | InChI=1S/C11H15ClO/c1-3-8-13-11-6-4-10(5-7-11)9(2)12/h4-7,9H,3,8H2,1-2H3 |
| InChiKey: | InChIKey=JEENXWZLAKTEML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.