* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-N-[2-(2,4-DICHLOROPHENYL)ETHYL]BENZENE-1,4-DIAMINE |
| English Synonyms: | 1-N-[2-(2,4-DICHLOROPHENYL)ETHYL]BENZENE-1,4-DIAMINE |
| MDL Number.: | MFCD11187173 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1N)NCCc2ccc(cc2Cl)Cl |
| InChi: | InChI=1S/C14H14Cl2N2/c15-11-2-1-10(14(16)9-11)7-8-18-13-5-3-12(17)4-6-13/h1-6,9,18H,7-8,17H2 |
| InChiKey: | InChIKey=YUTUUBZTFRWCNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.