* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[2-(4-AMINO-1H-PYRAZOL-1-YL)PROPANOYL]-3-ETHYLUREA |
English Synonyms: | 1-[2-(4-AMINO-1H-PYRAZOL-1-YL)PROPANOYL]-3-ETHYLUREA |
MDL Number.: | MFCD11187772 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCNC(=O)NC(=O)C(C)n1cc(cn1)N |
InChi: | InChI=1S/C9H15N5O2/c1-3-11-9(16)13-8(15)6(2)14-5-7(10)4-12-14/h4-6H,3,10H2,1-2H3,(H2,11,13,15,16) |
InChiKey: | InChIKey=NWDASNQNTAUMEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.