* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DECANIMIDAMIDE |
| English Synonyms: | DECANIMIDAMIDE |
| MDL Number.: | MFCD11198221 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCCC(=N)N |
| InChi: | InChI=1S/C10H22N2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H3,11,12) |
| InChiKey: | InChIKey=UFTQDTTYVKSPGS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.