* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DITHIENO[3,2-B:2',3'-D]THIOPHENE 4,4-DIOXIDE |
CAS: | 3807-53-2 |
English Synonyms: | DITHIENO[3,2-B:2',3'-D]THIOPHENE 4,4-DIOXIDE |
MDL Number.: | MFCD11215204 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1csc-2c1S(=O)(=O)c3c2scc3 |
InChi: | InChI=1S/C8H4O2S3/c9-13(10)5-1-3-11-7(5)8-6(13)2-4-12-8/h1-4H |
InChiKey: | InChIKey=MXTGSJWIWTXARD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.