* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 33157 |
| English Synonyms: | KINGSHCHEM 33157 |
| MDL Number.: | MFCD11218391 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | CCNC(=S)Nc1ccc(cc1)Nc2[nH]c3ccccc3n2 |
| InChi: | InChI=1S/C16H17N5S/c1-2-17-16(22)19-12-9-7-11(8-10-12)18-15-20-13-5-3-4-6-14(13)21-15/h3-10H,2H2,1H3,(H2,17,19,22)(H2,18,20,21) |
| InChiKey: | InChIKey=FMBQDMNHILMZAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.