* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-0605 |
English Synonyms: | IBSCREEN-BB BB_NC-0605 |
MDL Number.: | MFCD11501536 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOC(=O)/C(=C/1\CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C)C)C)/C#N |
InChi: | InChI=1S/C26H35NO4/c1-5-30-24(29)20(15-27)22-9-8-21-19-7-6-17-14-18(31-16(2)28)10-12-25(17,3)23(19)11-13-26(21,22)4/h6,18-19,21,23H,5,7-14H2,1-4H3/b22-20+/t18-,19-,21-,23-,25-,26-/m0/s1 |
InChiKey: | InChIKey=VNWWMZKAASJVJP-QUBJTGISSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.