* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,2'-BITHIOPHENE-5,5'-DIBORONIC ACID |
| CAS: | 189358-30-3 |
| English Synonyms: | 2,2'-BITHIOPHENE-5,5'-DIBORONIC ACID |
| MDL Number.: | MFCD11504864 |
| H bond acceptor: | 4 |
| H bond donor: | 4 |
| Smile: | B(c1ccc(s1)c2ccc(s2)B(O)O)(O)O |
| InChi: | InChI=1S/C8H8B2O4S2/c11-9(12)7-3-1-5(15-7)6-2-4-8(16-6)10(13)14/h1-4,11-14H |
| InChiKey: | InChIKey=GERFEEQVJFVEBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.