* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHA 568487 |
CAS: | 527680-56-4 |
English Synonyms: | PHA 568487 |
MDL Number.: | MFCD11519961 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1C(=O)N[C@H]3CN4CC[C@@H]3CC4)OCCO2.C(=C/C(=O)O)\C(=O)O |
InChi: | InChI=1S/C16H20N2O3.C4H4O4/c19-16(17-13-10-18-5-3-11(13)4-6-18)12-1-2-14-15(9-12)21-8-7-20-14;5-3(6)1-2-4(7)8/h1-2,9,11,13H,3-8,10H2,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-;/m0./s1 |
InChiKey: | InChIKey=QYQZUGYJVHHHEE-QDSMGTAFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.