* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | DEC-9-EN-2-ONE |
English Synonyms: | DEC-9-EN-2-ONE |
MDL Number.: | MFCD11553507 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)CCCCCCC=C |
InChi: | InChI=1S/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h3H,1,4-9H2,2H3 |
InChiKey: | InChIKey=DZECLZDTSQJBSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.