* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ALLYLANTHRACENE |
English Synonyms: | 9-ALLYLANTHRACENE |
MDL Number.: | MFCD11553672 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C=CCc1c2ccccc2cc3c1cccc3 |
InChi: | InChI=1S/C17H14/c1-2-7-17-15-10-5-3-8-13(15)12-14-9-4-6-11-16(14)17/h2-6,8-12H,1,7H2 |
InChiKey: | InChIKey=USRRYCXZCVGSQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.