* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRIDIN-2-YL(1H-1,2,3,4-TETRAZOL-5-YL)METHANAMINE |
English Synonyms: | PYRIDIN-2-YL(1H-1,2,3,4-TETRAZOL-5-YL)METHANAMINE |
MDL Number.: | MFCD11592502 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccnc(c1)C(c2[nH]nnn2)N |
InChi: | InChI=1S/C7H8N6/c8-6(7-10-12-13-11-7)5-3-1-2-4-9-5/h1-4,6H,8H2,(H,10,11,12,13) |
InChiKey: | InChIKey=GYZBMGIZEQICFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.