* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-XANTHEN-9-YLHYDRAZINE |
English Synonyms: | 9H-XANTHEN-9-YLHYDRAZINE |
MDL Number.: | MFCD11641872 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)C(c3ccccc3O2)NN |
InChi: | InChI=1S/C13H12N2O/c14-15-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)13/h1-8,13,15H,14H2 |
InChiKey: | InChIKey=VVVUMLCPZPAWHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.