* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BROMO-9H-XANTHENE |
English Synonyms: | 9-BROMO-9H-XANTHENE |
MDL Number.: | MFCD11641873 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)C(c3ccccc3O2)Br |
InChi: | InChI=1S/C13H9BrO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13H |
InChiKey: | InChIKey=CDERKFMYLMXWJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.