* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-BROMO-2,3,4,5-TETRAHYDRO-1LAMBDA(6)-BENZOTHIEPINE-1,1,5-TRIONE |
| English Synonyms: | 9-BROMO-2,3,4,5-TETRAHYDRO-1LAMBDA(6)-BENZOTHIEPINE-1,1,5-TRIONE |
| MDL Number.: | MFCD11642529 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2c(c(c1)Br)S(=O)(=O)CCCC2=O |
| InChi: | InChI=1S/C10H9BrO3S/c11-8-4-1-3-7-9(12)5-2-6-15(13,14)10(7)8/h1,3-4H,2,5-6H2 |
| InChiKey: | InChIKey=SJDWYWQOFZDHEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.