* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEX-5-YN-2-ONE |
English Synonyms: | 5-HEXYN-2-ONE ; HEX-5-YN-2-ONE |
MDL Number.: | MFCD11655155 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)CCC#C |
InChi: | InChI=1S/C6H8O/c1-3-4-5-6(2)7/h1H,4-5H2,2H3 |
InChiKey: | InChIKey=MQVQPQJPNZJTAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.