* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEPT-6-EN-3-ONE |
English Synonyms: | HEPT-6-EN-3-ONE |
MDL Number.: | MFCD11655265 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCC(=O)CCC=C |
InChi: | InChI=1S/C7H12O/c1-3-5-6-7(8)4-2/h3H,1,4-6H2,2H3 |
InChiKey: | InChIKey=BSYCQORECWMSQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.