* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DECAN-4-AMINE |
English Synonyms: | DECAN-4-AMINE |
MDL Number.: | MFCD11655408 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCCCCC(CCC)N |
InChi: | InChI=1S/C10H23N/c1-3-5-6-7-9-10(11)8-4-2/h10H,3-9,11H2,1-2H3 |
InChiKey: | InChIKey=JYRWFZZKEKTMSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.