* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DODECAN-4-AMINE |
| English Synonyms: | DODECAN-4-AMINE |
| MDL Number.: | MFCD11655415 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCC(CCC)N |
| InChi: | InChI=1S/C12H27N/c1-3-5-6-7-8-9-11-12(13)10-4-2/h12H,3-11,13H2,1-2H3 |
| InChiKey: | InChIKey=VMQZMLUHQGRJER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.