* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HYRCANOSIDE |
| CAS: | 15001-93-1 |
| English Synonyms: | HYRCANOSIDE |
| MDL Number.: | MFCD11655986 |
| H bond acceptor: | 14 |
| H bond donor: | 7 |
| Smile: | C[C@]12CC[C@H]3[C@H]([C@]1(CC[C@@H]2C4=CC(=O)OC4)O)CCC5=C[C@H](CC[C@]35C=O)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O |
| InChi: | InChI=1S/C34H48O14/c1-32-7-5-20-21(34(32,43)9-6-19(32)16-10-24(37)44-13-16)3-2-17-11-18(4-8-33(17,20)15-36)46-30-28(41)26(39)23(14-45-30)48-31-29(42)27(40)25(38)22(12-35)47-31/h10-11,15,18-23,25-31,35,38-43H,2-9,12-14H2,1H3/t18-,19+,20-,21+,22+,23+,25+,26-,27-,28+,29+,30-,31-,32+,33+,34-/m0/s1 |
| InChiKey: | InChIKey=HFXNSSUZFCOFIY-XOHMQVQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.