* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHOXY-1,4,5,8-TETRAHYDRO-1,4:5,8-DIOXA-ANTHRACENE |
English Synonyms: | 9-METHOXY-1,4,5,8-TETRAHYDRO-1,4:5,8-DIOXA-ANTHRACENE |
MDL Number.: | MFCD11707122 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COc1c2c(cc3c1[C@@H]4C=C[C@H]3O4)[C@@H]5C=C[C@H]2O5 |
InChi: | InChI=1S/C15H12O3/c1-16-15-13-7(9-2-4-11(13)17-9)6-8-10-3-5-12(18-10)14(8)15/h2-6,9-12H,1H3/t9-,10+,11+,12- |
InChiKey: | InChIKey=SJNFCULQXDYLFS-IWDIQUIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.